C24H25N2OSi+ — CID 164721994
trimethyl-(3,5,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)silane (PubChem CID 164721994) has the molecular formula C24H25N2OSi+ and a molecular weight of 385.56 g/mol. Its IUPAC name is trimethyl-(3,5,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)silane.
| Compound Name | trimethyl-(3,5,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)silane |
|---|---|
| PubChem CID | 164721994 |
| Molecular Formula | C24H25N2OSi+ |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | trimethyl-(3,5,20-trimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-15-yl)silane |
| SMILES | Cc1cccc2cc3c(c(C)c12)-c1c2c(cc([Si](C)(C)C)cc2nc[n+]1C)O3 |
| InChI | InChI=1S/C24H25N2OSi/c1-14-8-7-9-16-10-19-22(15(2)21(14)16)24-23-18(25-13-26(24)3)11-17(28(4,5)6)12-20(23)27-19/h7-13H,1-6H3/q+1 |
| InChIKey | DSHIWVIBRWWFHX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|