C29H24NO+ — CID 164722657
15-(2,6-dimethylphenyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 164722657) has the molecular formula C29H24NO+ and a molecular weight of 402.52 g/mol. Its IUPAC name is 15-(2,6-dimethylphenyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 15-(2,6-dimethylphenyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722657 |
| Molecular Formula | C29H24NO+ |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 15-(2,6-dimethylphenyl)-3,20-dimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | Cc1cccc(C)c1-c1cc2c3c([n+](C)ccc3c1)-c1c(cc3ccccc3c1C)O2 |
| InChI | InChI=1S/C29H24NO/c1-17-8-7-9-18(2)26(17)22-14-21-12-13-30(4)29-27-19(3)23-11-6-5-10-20(23)15-24(27)31-25(16-22)28(21)29/h5-16H,1-4H3/q+1 |
| InChIKey | HVEFJVYDBSOLFY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|