C26H22NO2+ — CID 164723017
3,23-dimethyl-18-propan-2-yl-11,15-dioxa-23-azoniahexacyclo[14.7.1.02,14.04,12.05,10.020,24]tetracosa-1(23),2(14),3,5,7,9,12,16(24),17,19,21-undecaene (PubChem CID 164723017) has the molecular formula C26H22NO2+ and a molecular weight of 380.47 g/mol. Its IUPAC name is 3,23-dimethyl-18-propan-2-yl-11,15-dioxa-23-azoniahexacyclo[14.7.1.02,14.04,12.05,10.020,24]tetracosa-1(23),2(14),3,5,7,9,12,16(24),17,19,21-undecaene.
| Compound Name | 3,23-dimethyl-18-propan-2-yl-11,15-dioxa-23-azoniahexacyclo[14.7.1.02,14.04,12.05,10.020,24]tetracosa-1(23),2(14),3,5,7,9,12,16(24),17,19,21-undecaene |
|---|---|
| PubChem CID | 164723017 |
| Molecular Formula | C26H22NO2+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3,23-dimethyl-18-propan-2-yl-11,15-dioxa-23-azoniahexacyclo[14.7.1.02,14.04,12.05,10.020,24]tetracosa-1(23),2(14),3,5,7,9,12,16(24),17,19,21-undecaene |
| SMILES | Cc1c2c(cc3oc4ccccc4c13)Oc1cc(C(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C26H22NO2/c1-14(2)17-11-16-9-10-27(4)26-24-15(3)23-18-7-5-6-8-19(18)28-21(23)13-22(24)29-20(12-17)25(16)26/h5-14H,1-4H3/q+1 |
| InChIKey | NYABQXDFSSWSDI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|