C26H26NO+ — CID 164722352
3,10,14,20-tetramethyl-15-propan-2-yl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 164722352) has the molecular formula C26H26NO+ and a molecular weight of 368.50 g/mol. Its IUPAC name is 3,10,14,20-tetramethyl-15-propan-2-yl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 3,10,14,20-tetramethyl-15-propan-2-yl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722352 |
| Molecular Formula | C26H26NO+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3,10,14,20-tetramethyl-15-propan-2-yl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | Cc1c(C(C)C)cc2cc[n+](C)c3c2c1Oc1c-3c(C)c2ccccc2c1C |
| InChI | InChI=1S/C26H26NO/c1-14(2)21-13-18-11-12-27(6)24-22-15(3)19-9-7-8-10-20(19)16(4)25(22)28-26(17(21)5)23(18)24/h7-14H,1-6H3/q+1 |
| InChIKey | OKRYXWWVUONFCM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|