C29H22NO2+ — CID 164722433
phenyl-(3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-15-yl)methanone (PubChem CID 164722433) has the molecular formula C29H22NO2+ and a molecular weight of 416.50 g/mol. Its IUPAC name is phenyl-(3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-15-yl)methanone.
| Compound Name | phenyl-(3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-15-yl)methanone |
|---|---|
| PubChem CID | 164722433 |
| Molecular Formula | C29H22NO2+ |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | phenyl-(3,10,20-trimethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-15-yl)methanone |
| SMILES | Cc1c2c(c(C)c3ccccc13)-c1c3c(cc(C(=O)c4ccccc4)cc3cc[n+]1C)O2 |
| InChI | InChI=1S/C29H22NO2/c1-17-22-11-7-8-12-23(22)18(2)29-25(17)27-26-20(13-14-30(27)3)15-21(16-24(26)32-29)28(31)19-9-5-4-6-10-19/h4-16H,1-3H3/q+1 |
| InChIKey | WUXTYOZCFZCAFZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|