C30H34NO+ — CID 164723283
3,10,20-trimethyl-6,15-bis(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene (PubChem CID 164723283) has the molecular formula C30H34NO+ and a molecular weight of 424.61 g/mol. Its IUPAC name is 3,10,20-trimethyl-6,15-bis(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene.
| Compound Name | 3,10,20-trimethyl-6,15-bis(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164723283 |
| Molecular Formula | C30H34NO+ |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 3,10,20-trimethyl-6,15-bis(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
| SMILES | Cc1c2c(c(C)c3cc(CC(C)C)ccc13)-c1c3c(cc(CC(C)C)cc3cc[n+]1C)O2 |
| InChI | InChI=1S/C30H34NO/c1-17(2)12-21-8-9-24-20(6)30-27(19(5)25(24)15-21)29-28-23(10-11-31(29)7)14-22(13-18(3)4)16-26(28)32-30/h8-11,14-18H,12-13H2,1-7H3/q+1 |
| InChIKey | GYESUSZDVGELRX-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|