C29H34NOSi+ — CID 164723009
trimethyl-[3,8,20-trimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]silane (PubChem CID 164723009) has the molecular formula C29H34NOSi+ and a molecular weight of 440.68 g/mol. Its IUPAC name is trimethyl-[3,8,20-trimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]silane.
| Compound Name | trimethyl-[3,8,20-trimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]silane |
|---|---|
| PubChem CID | 164723009 |
| Molecular Formula | C29H34NOSi+ |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | trimethyl-[3,8,20-trimethyl-15-(2-methylpropyl)-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaen-10-yl]silane |
| SMILES | Cc1c2c(c([Si](C)(C)C)c3c(C)cccc13)Oc1cc(CC(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C29H34NOSi/c1-17(2)14-20-15-21-12-13-30(5)27-25-19(4)22-11-9-10-18(3)24(22)29(32(6,7)8)28(25)31-23(16-20)26(21)27/h9-13,15-17H,14H2,1-8H3/q+1 |
| InChIKey | PMWSDWFFFDZPTQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|