C23H18N3O+ — CID 164723560
15-(isocyanomethyl)-3,10,20-trimethyl-12-oxa-8-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene (PubChem CID 164723560) has the molecular formula C23H18N3O+ and a molecular weight of 352.42 g/mol. Its IUPAC name is 15-(isocyanomethyl)-3,10,20-trimethyl-12-oxa-8-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene.
| Compound Name | 15-(isocyanomethyl)-3,10,20-trimethyl-12-oxa-8-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164723560 |
| Molecular Formula | C23H18N3O+ |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 15-(isocyanomethyl)-3,10,20-trimethyl-12-oxa-8-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2(11),3,5,7,9,13(21),14,16,18-decaene |
| SMILES | [C-]#[N+]Cc1cc2c3c([n+](C)ccc3c1)-c1c(c(C)c3ncccc3c1C)O2 |
| InChI | InChI=1S/C23H18N3O/c1-13-17-6-5-8-25-21(17)14(2)23-19(13)22-20-16(7-9-26(22)4)10-15(12-24-3)11-18(20)27-23/h5-11H,12H2,1-2,4H3/q+1 |
| InChIKey | HGZFEMKEPVXXRF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 30.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|