C27H28NO+ — CID 164722826
15-tert-butyl-3,8,10,20-tetramethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 164722826) has the molecular formula C27H28NO+ and a molecular weight of 382.53 g/mol. Its IUPAC name is 15-tert-butyl-3,8,10,20-tetramethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 15-tert-butyl-3,8,10,20-tetramethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722826 |
| Molecular Formula | C27H28NO+ |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 15-tert-butyl-3,8,10,20-tetramethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | Cc1c2c(c(C)c3c(C)cccc13)Oc1cc(C(C)(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C27H28NO/c1-15-9-8-10-20-16(2)23-25-24-18(11-12-28(25)7)13-19(27(4,5)6)14-21(24)29-26(23)17(3)22(15)20/h8-14H,1-7H3/q+1 |
| InChIKey | DDHSRAHAPQHAMI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|