C25H20N3O+ — CID 164722163
6-(isocyanomethyl)-11,14-dimethyl-3-oxa-9-aza-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4,6,8(24),9,11,13,15,17,19(23)-decaene (PubChem CID 164722163) has the molecular formula C25H20N3O+ and a molecular weight of 378.46 g/mol. Its IUPAC name is 6-(isocyanomethyl)-11,14-dimethyl-3-oxa-9-aza-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4,6,8(24),9,11,13,15,17,19(23)-decaene.
| Compound Name | 6-(isocyanomethyl)-11,14-dimethyl-3-oxa-9-aza-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4,6,8(24),9,11,13,15,17,19(23)-decaene |
|---|---|
| PubChem CID | 164722163 |
| Molecular Formula | C25H20N3O+ |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 6-(isocyanomethyl)-11,14-dimethyl-3-oxa-9-aza-11-azoniahexacyclo[13.7.1.14,8.02,13.019,23.012,24]tetracosa-1,4,6,8(24),9,11,13,15,17,19(23)-decaene |
| SMILES | [C-]#[N+]Cc1cc2c3c([n+](C)cnc3c1)-c1c(c3c4c(cccc4c1C)CCC3)O2 |
| InChI | InChI=1S/C25H20N3O/c1-14-17-8-4-6-16-7-5-9-18(22(16)17)25-21(14)24-23-19(27-13-28(24)3)10-15(12-26-2)11-20(23)29-25/h4,6,8,10-11,13H,5,7,9,12H2,1,3H3/q+1 |
| InChIKey | OBASJBANYNARCV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 30.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|