C29H27N2O+ — CID 164723376
16-(2-bicyclo[2.2.1]heptanyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene (PubChem CID 164723376) has the molecular formula C29H27N2O+ and a molecular weight of 419.55 g/mol. Its IUPAC name is 16-(2-bicyclo[2.2.1]heptanyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene.
| Compound Name | 16-(2-bicyclo[2.2.1]heptanyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene |
|---|---|
| PubChem CID | 164723376 |
| Molecular Formula | C29H27N2O+ |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 16-(2-bicyclo[2.2.1]heptanyl)-3,21-dimethyl-13-oxa-19-aza-21-azoniahexacyclo[12.7.1.14,8.02,12.018,22.011,23]tricosa-1(21),2,4,6,8(23),11,14,16,18(22),19-decaene |
| SMILES | Cc1c2c(c3c4c(cccc14)CC3)Oc1cc(C3CC4CCC3C4)cc3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C29H27N2O/c1-15-20-5-3-4-17-8-9-21(26(17)20)29-25(15)28-27-23(30-14-31(28)2)12-19(13-24(27)32-29)22-11-16-6-7-18(22)10-16/h3-5,12-14,16,18,22H,6-11H2,1-2H3/q+1 |
| InChIKey | LREOMERDVZKUQE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|