C31H33N2O+ — CID 164722468
15-(2-bicyclo[2.2.1]heptanyl)-10-tert-butyl-3,20-dimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 164722468) has the molecular formula C31H33N2O+ and a molecular weight of 449.62 g/mol. Its IUPAC name is 15-(2-bicyclo[2.2.1]heptanyl)-10-tert-butyl-3,20-dimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 15-(2-bicyclo[2.2.1]heptanyl)-10-tert-butyl-3,20-dimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 164722468 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 15-(2-bicyclo[2.2.1]heptanyl)-10-tert-butyl-3,20-dimethyl-12-oxa-18-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1c2c(c(C(C)(C)C)c3ccccc13)Oc1cc(C3CC4CCC3C4)cc3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C31H33N2O/c1-17-21-8-6-7-9-22(21)28(31(2,3)4)30-26(17)29-27-24(32-16-33(29)5)14-20(15-25(27)34-30)23-13-18-10-11-19(23)12-18/h6-9,14-16,18-19,23H,10-13H2,1-5H3/q+1 |
| InChIKey | WBRNOJGTSJWVOC-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|