C19H14NO2+ — CID 164722064
3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12,14,16(20),17-nonaene (PubChem CID 164722064) has the molecular formula C19H14NO2+ and a molecular weight of 288.33 g/mol. Its IUPAC name is 3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12,14,16(20),17-nonaene.
| Compound Name | 3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 164722064 |
| Molecular Formula | C19H14NO2+ |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3,19-dimethyl-5,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,6,8,12,14,16(20),17-nonaene |
| SMILES | Cc1c2c(cc3ccoc13)Oc1cccc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C19H14NO2/c1-11-16-15(10-13-7-9-21-19(11)13)22-14-5-3-4-12-6-8-20(2)18(16)17(12)14/h3-10H,1-2H3/q+1 |
| InChIKey | OMOMCHXNBCGGCP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|