C26H26NO2+ — CID 164722734
14-cyclohexyl-3,9,19-trimethyl-7,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene (PubChem CID 164722734) has the molecular formula C26H26NO2+ and a molecular weight of 384.50 g/mol. Its IUPAC name is 14-cyclohexyl-3,9,19-trimethyl-7,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene.
| Compound Name | 14-cyclohexyl-3,9,19-trimethyl-7,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
|---|---|
| PubChem CID | 164722734 |
| Molecular Formula | C26H26NO2+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 14-cyclohexyl-3,9,19-trimethyl-7,11-dioxa-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
| SMILES | Cc1c2c(c(C)c3occc13)Oc1cc(C3CCCCC3)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C26H26NO2/c1-15-20-10-12-28-25(20)16(2)26-22(15)24-23-18(9-11-27(24)3)13-19(14-21(23)29-26)17-7-5-4-6-8-17/h9-14,17H,4-8H2,1-3H3/q+1 |
| InChIKey | XAUIDUSPOKHRAH-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|