C36H38NO+ — CID 168732615
10-tert-butyl-17-cyclohexyl-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene (PubChem CID 168732615) has the molecular formula C36H38NO+ and a molecular weight of 500.71 g/mol. Its IUPAC name is 10-tert-butyl-17-cyclohexyl-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene.
| Compound Name | 10-tert-butyl-17-cyclohexyl-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 168732615 |
| Molecular Formula | C36H38NO+ |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 10-tert-butyl-17-cyclohexyl-3,6,24-trimethyl-12-oxa-24-azoniahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14,16,18,20,22-dodecaene |
| SMILES | Cc1ccc2c(C(C)(C)C)c3c(c(C)c2c1)-c1c2c(cc4cc(C5CCCCC5)ccc4c2cc[n+]1C)O3 |
| InChI | InChI=1S/C36H38NO/c1-21-12-14-28-29(18-21)22(2)31-34-32-27(16-17-37(34)6)26-15-13-24(23-10-8-7-9-11-23)19-25(26)20-30(32)38-35(31)33(28)36(3,4)5/h12-20,23H,7-11H2,1-6H3/q+1 |
| InChIKey | JRQKNPBYJRFCRK-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|