C27H27NP+ — CID 164722047
15-cyclopentyl-3,12,20-trimethyl-20-azonia-12-phosphapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 164722047) has the molecular formula C27H27NP+ and a molecular weight of 396.49 g/mol. Its IUPAC name is 15-cyclopentyl-3,12,20-trimethyl-20-azonia-12-phosphapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 15-cyclopentyl-3,12,20-trimethyl-20-azonia-12-phosphapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722047 |
| Molecular Formula | C27H27NP+ |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 15-cyclopentyl-3,12,20-trimethyl-20-azonia-12-phosphapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | Cc1c2c(cc3ccccc13)P(C)c1cc(C3CCCC3)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C27H27NP/c1-17-22-11-7-6-10-19(22)15-23-25(17)27-26-20(12-13-28(27)2)14-21(16-24(26)29(23)3)18-8-4-5-9-18/h6-7,10-16,18H,4-5,8-9H2,1-3H3/q+1 |
| InChIKey | MEMKBYBZJTYEFQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|