C23H25N2OSi+ — CID 164722638
trimethyl-(3,11,19-trimethyl-7-oxa-11-aza-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaen-14-yl)silane (PubChem CID 164722638) has the molecular formula C23H25N2OSi+ and a molecular weight of 373.55 g/mol. Its IUPAC name is trimethyl-(3,11,19-trimethyl-7-oxa-11-aza-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaen-14-yl)silane.
| Compound Name | trimethyl-(3,11,19-trimethyl-7-oxa-11-aza-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaen-14-yl)silane |
|---|---|
| PubChem CID | 164722638 |
| Molecular Formula | C23H25N2OSi+ |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | trimethyl-(3,11,19-trimethyl-7-oxa-11-aza-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12(20),13,15,17-nonaen-14-yl)silane |
| SMILES | Cc1c2c(cc3occc13)N(C)c1cc([Si](C)(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C23H25N2OSi/c1-14-17-8-10-26-20(17)13-19-21(14)23-22-15(7-9-24(23)2)11-16(27(4,5)6)12-18(22)25(19)3/h7-13H,1-6H3/q+1 |
| InChIKey | WCSSNYPUYSQNRU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|