C27H29N2+ — CID 164722962
15-(2,2-dimethylpropyl)-3,12,20-trimethyl-12-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene (PubChem CID 164722962) has the molecular formula C27H29N2+ and a molecular weight of 381.54 g/mol. Its IUPAC name is 15-(2,2-dimethylpropyl)-3,12,20-trimethyl-12-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene.
| Compound Name | 15-(2,2-dimethylpropyl)-3,12,20-trimethyl-12-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
|---|---|
| PubChem CID | 164722962 |
| Molecular Formula | C27H29N2+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 15-(2,2-dimethylpropyl)-3,12,20-trimethyl-12-aza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13(21),14,16,18-decaene |
| SMILES | Cc1c2c(cc3ccccc13)N(C)c1cc(CC(C)(C)C)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C27H29N2/c1-17-21-10-8-7-9-19(21)15-23-24(17)26-25-20(11-12-28(26)5)13-18(16-27(2,3)4)14-22(25)29(23)6/h7-15H,16H2,1-6H3/q+1 |
| InChIKey | AHNSJMJUUKKCOY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|