C29H32N3+ — CID 164723257
15-(4,4-dimethylcyclohexyl)-3,12,20-trimethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 164723257) has the molecular formula C29H32N3+ and a molecular weight of 422.60 g/mol. Its IUPAC name is 15-(4,4-dimethylcyclohexyl)-3,12,20-trimethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 15-(4,4-dimethylcyclohexyl)-3,12,20-trimethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 164723257 |
| Molecular Formula | C29H32N3+ |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 15-(4,4-dimethylcyclohexyl)-3,12,20-trimethyl-12,18-diaza-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1c2c(cc3ccccc13)N(C)c1cc(C3CCC(C)(C)CC3)cc3nc[n+](C)c-2c13 |
| InChI | InChI=1S/C29H32N3/c1-18-22-9-7-6-8-20(22)15-24-26(18)28-27-23(30-17-31(28)4)14-21(16-25(27)32(24)5)19-10-12-29(2,3)13-11-19/h6-9,14-17,19H,10-13H2,1-5H3/q+1 |
| InChIKey | RMEIBTMFYWSTDQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|