C26H23N2O+ — CID 170655309
2,4,6,7,10-pentamethyl-15-oxa-2-aza-10-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,21]tetracosa-1(24),3,5,7,9,11,13,16,18,20,22-undecaene (PubChem CID 170655309) has the molecular formula C26H23N2O+ and a molecular weight of 379.48 g/mol. Its IUPAC name is 2,4,6,7,10-pentamethyl-15-oxa-2-aza-10-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,21]tetracosa-1(24),3,5,7,9,11,13,16,18,20,22-undecaene.
| Compound Name | 2,4,6,7,10-pentamethyl-15-oxa-2-aza-10-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,21]tetracosa-1(24),3,5,7,9,11,13,16,18,20,22-undecaene |
|---|---|
| PubChem CID | 170655309 |
| Molecular Formula | C26H23N2O+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2,4,6,7,10-pentamethyl-15-oxa-2-aza-10-azoniahexacyclo[11.10.1.03,8.09,24.014,22.016,21]tetracosa-1(24),3,5,7,9,11,13,16,18,20,22-undecaene |
| SMILES | Cc1cc(C)c2c(c1C)-c1c3c(cc4c5ccccc5oc4c3cc[n+]1C)N2C |
| InChI | InChI=1S/C26H23N2O/c1-14-12-15(2)24-22(16(14)3)25-23-18(10-11-27(25)4)26-19(13-20(23)28(24)5)17-8-6-7-9-21(17)29-26/h6-13H,1-5H3/q+1 |
| InChIKey | TXCLEXUXOQMBHG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|