C33H40NOSi+ — CID 155638317
[1-(2,3-dimethyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane (PubChem CID 155638317) has the molecular formula C33H40NOSi+ and a molecular weight of 494.78 g/mol. Its IUPAC name is [1-(2,3-dimethyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane.
| Compound Name | [1-(2,3-dimethyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 155638317 |
| Molecular Formula | C33H40NOSi+ |
| Molecular Weight | 494.78 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [1-(2,3-dimethyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium-6-yl]-tri(propan-2-yl)silane |
| SMILES | Cc1cc2c(oc3ccccc32)c(-c2c3ccc([Si](C(C)C)(C(C)C)C(C)C)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C33H40NOSi/c1-20(2)36(21(3)4,22(5)6)26-14-15-27-25(19-26)16-17-34(9)32(27)31-24(8)23(7)18-29-28-12-10-11-13-30(28)35-33(29)31/h10-22H,1-9H3/q+1 |
| InChIKey | JUUXCDOWXHMHRL-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.78 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|