C31H28NO+ — CID 158897566
6-(2-deuteriopropan-2-yl)-1-(8,9-dimethylnaphtho[1,2-b][1]benzofuran-10-yl)-2-methylisoquinolin-2-ium (PubChem CID 158897566) has the molecular formula C31H28NO+ and a molecular weight of 431.58 g/mol. Its IUPAC name is 6-(2-deuteriopropan-2-yl)-1-(8,9-dimethylnaphtho[1,2-b][1]benzofuran-10-yl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-(2-deuteriopropan-2-yl)-1-(8,9-dimethylnaphtho[1,2-b][1]benzofuran-10-yl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 158897566 |
| Molecular Formula | C31H28NO+ |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 6-(2-deuteriopropan-2-yl)-1-(8,9-dimethylnaphtho[1,2-b][1]benzofuran-10-yl)-2-methylisoquinolin-2-ium |
| SMILES | [2H]C(C)(C)c1ccc2c(-c3c(C)c(C)cc4c3oc3c5ccccc5ccc43)[n+](C)ccc2c1 |
| InChI | InChI=1S/C31H28NO/c1-18(2)22-11-12-24-23(17-22)14-15-32(5)29(24)28-20(4)19(3)16-27-26-13-10-21-8-6-7-9-25(21)30(26)33-31(27)28/h6-18H,1-5H3/q+1/i18D |
| InChIKey | YONHMERUTRRAAN-VAAKKRCDSA-N |
| XLogP | 8.12 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|