C30H26NO+ — CID 140827935
6-(2-deuteriopropan-2-yl)-2-methyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)isoquinolin-2-ium (PubChem CID 140827935) has the molecular formula C30H26NO+ and a molecular weight of 417.55 g/mol. Its IUPAC name is 6-(2-deuteriopropan-2-yl)-2-methyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)isoquinolin-2-ium.
| Compound Name | 6-(2-deuteriopropan-2-yl)-2-methyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 140827935 |
| Molecular Formula | C30H26NO+ |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 6-(2-deuteriopropan-2-yl)-2-methyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)isoquinolin-2-ium |
| SMILES | [2H]C(C)(C)c1ccc2c(-c3c(C)ccc4c3oc3c5ccccc5ccc43)[n+](C)ccc2c1 |
| InChI | InChI=1S/C30H26NO/c1-18(2)21-11-13-23-22(17-21)15-16-31(4)28(23)27-19(3)9-12-26-25-14-10-20-7-5-6-8-24(20)29(25)32-30(26)27/h5-18H,1-4H3/q+1/i18D |
| InChIKey | OOXJNNAQMAMPJI-VAAKKRCDSA-N |
| XLogP | 7.82 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|