C27H26NO+ — CID 167365073
1,5-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-propan-2-ylpyridin-1-ium (PubChem CID 167365073) has the molecular formula C27H26NO+ and a molecular weight of 380.51 g/mol. Its IUPAC name is 1,5-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-propan-2-ylpyridin-1-ium.
| Compound Name | 1,5-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 167365073 |
| Molecular Formula | C27H26NO+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1,5-dimethyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2oc2c4ccccc4ccc32)cc1C(C)C |
| InChI | InChI=1S/C27H26NO/c1-16(2)23-14-24(28(5)15-18(23)4)25-17(3)10-12-22-21-13-11-19-8-6-7-9-20(19)26(21)29-27(22)25/h6-16H,1-5H3/q+1 |
| InChIKey | NMSVQEOCVXYUCN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|