C29H26F2NO+ — CID 153464345
2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium (PubChem CID 153464345) has the molecular formula C29H26F2NO+ and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 153464345 |
| Molecular Formula | C29H26F2NO+ |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(1,7-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2c(C)cc(F)c3c2oc2c(-c4ccccc4)c(F)ccc23)cc1C(C)C |
| InChI | InChI=1S/C29H26F2NO/c1-16(2)21-14-24(32(5)15-18(21)4)25-17(3)13-23(31)27-20-11-12-22(30)26(28(20)33-29(25)27)19-9-7-6-8-10-19/h6-16H,1-5H3/q+1 |
| InChIKey | SJSKLPNQJYHTBL-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|