C35H31FNO+ — CID 167357630
2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,4-dimethyl-5-propan-2-ylpyridin-1-ium (PubChem CID 167357630) has the molecular formula C35H31FNO+ and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,4-dimethyl-5-propan-2-ylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,4-dimethyl-5-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 167357630 |
| Molecular Formula | C35H31FNO+ |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1,4-dimethyl-5-propan-2-ylpyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2c(-c4ccc(-c5ccccc5)cc4)c(F)ccc23)[n+](C)cc1C(C)C |
| InChI | InChI=1S/C35H31FNO/c1-21(2)29-20-37(5)31(19-23(29)4)32-22(3)11-16-27-28-17-18-30(36)33(35(28)38-34(27)32)26-14-12-25(13-15-26)24-9-7-6-8-10-24/h6-21H,1-5H3/q+1 |
| InChIKey | DNPDLESUFOQLMI-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|