C34H30F2NOSi+ — CID 169282849
[5-fluoro-2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane (PubChem CID 169282849) has the molecular formula C34H30F2NOSi+ and a molecular weight of 534.70 g/mol. Its IUPAC name is [5-fluoro-2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane.
| Compound Name | [5-fluoro-2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 169282849 |
| Molecular Formula | C34H30F2NOSi+ |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [5-fluoro-2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium-4-yl]-trimethylsilane |
| SMILES | Cc1ccc2c(oc3c(-c4cccc(-c5ccccc5)c4)c(F)ccc32)c1-c1cc([Si](C)(C)C)c(F)c[n+]1C |
| InChI | InChI=1S/C34H30F2NOSi/c1-21-14-15-25-26-16-17-27(35)32(24-13-9-12-23(18-24)22-10-7-6-8-11-22)34(26)38-33(25)31(21)29-19-30(39(3,4)5)28(36)20-37(29)2/h6-20H,1-5H3/q+1 |
| InChIKey | IBANBCSJUKWHDW-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|