C29H21FNOS+ — CID 164850003
2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-thiazol-3-ium (PubChem CID 164850003) has the molecular formula C29H21FNOS+ and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-thiazol-3-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 164850003 |
| Molecular Formula | C29H21FNOS+ |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-(3-phenylphenyl)dibenzofuran-4-yl]-3-methyl-1,3-thiazol-3-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cccc(-c5ccccc5)c4)c(F)ccc32)c1-c1scc[n+]1C |
| InChI | InChI=1S/C29H21FNOS/c1-18-11-12-22-23-13-14-24(30)26(21-10-6-9-20(17-21)19-7-4-3-5-8-19)28(23)32-27(22)25(18)29-31(2)15-16-33-29/h3-17H,1-2H3/q+1 |
| InChIKey | DENFUSCQMXOWBJ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|