C30H21N2OS+ — CID 164849329
7-methyl-6-(3-methyl-1,3-thiazol-3-ium-2-yl)-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile (PubChem CID 164849329) has the molecular formula C30H21N2OS+ and a molecular weight of 457.58 g/mol. Its IUPAC name is 7-methyl-6-(3-methyl-1,3-thiazol-3-ium-2-yl)-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-6-(3-methyl-1,3-thiazol-3-ium-2-yl)-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 164849329 |
| Molecular Formula | C30H21N2OS+ |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 7-methyl-6-(3-methyl-1,3-thiazol-3-ium-2-yl)-4-(4-phenylphenyl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(-c5ccccc5)cc4)c(C#N)ccc32)c1-c1scc[n+]1C |
| InChI | InChI=1S/C30H21N2OS/c1-19-8-14-24-25-15-13-23(18-31)27(22-11-9-21(10-12-22)20-6-4-3-5-7-20)29(25)33-28(24)26(19)30-32(2)16-17-34-30/h3-17H,1-2H3/q+1 |
| InChIKey | DZWZERDMFWPJIB-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|