C34H24N3O+ — CID 164849873
7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)-4-naphthalen-2-yldibenzofuran-3-carbonitrile (PubChem CID 164849873) has the molecular formula C34H24N3O+ and a molecular weight of 490.59 g/mol. Its IUPAC name is 7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)-4-naphthalen-2-yldibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)-4-naphthalen-2-yldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 164849873 |
| Molecular Formula | C34H24N3O+ |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 7-methyl-6-(1-methyl-3-phenylimidazol-1-ium-2-yl)-4-naphthalen-2-yldibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5ccccc5c4)c(C#N)ccc32)c1-c1n(-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C34H24N3O/c1-22-12-16-28-29-17-15-26(21-35)31(25-14-13-23-8-6-7-9-24(23)20-25)33(29)38-32(28)30(22)34-36(2)18-19-37(34)27-10-4-3-5-11-27/h3-20H,1-2H3/q+1 |
| InChIKey | WUVNVASQGNWUOX-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 45.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|