C33H22N3O2+ — CID 166043379
4-(4-cyano-3-phenoxyphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 166043379) has the molecular formula C33H22N3O2+ and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-(4-cyano-3-phenoxyphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 4-(4-cyano-3-phenoxyphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166043379 |
| Molecular Formula | C33H22N3O2+ |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 4-(4-cyano-3-phenoxyphenyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C#N)c(Oc5ccccc5)c4)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C33H22N3O2/c1-21-11-15-26-27-16-14-24(20-35)31(33(27)38-32(26)30(21)28-10-6-7-17-36(28)2)22-12-13-23(19-34)29(18-22)37-25-8-4-3-5-9-25/h3-18H,1-2H3/q+1 |
| InChIKey | RJZFBZGVQGSXAA-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 73.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|