C42H45N2OSi+ — CID 172542836
4-[4-[bis(2,2-dimethylpropyl)-phenylsilyl]phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 172542836) has the molecular formula C42H45N2OSi+ and a molecular weight of 621.92 g/mol. Its IUPAC name is 4-[4-[bis(2,2-dimethylpropyl)-phenylsilyl]phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 4-[4-[bis(2,2-dimethylpropyl)-phenylsilyl]phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 172542836 |
| Molecular Formula | C42H45N2OSi+ |
| Molecular Weight | 621.92 g/mol |
| Exact Mass | 621.33 |
| IUPAC Name | 4-[4-[bis(2,2-dimethylpropyl)-phenylsilyl]phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc([Si](CC(C)(C)C)(CC(C)(C)C)c5ccccc5)cc4)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C42H45N2OSi/c1-29-17-23-34-35-24-20-31(26-43)38(40(35)45-39(34)37(29)36-16-12-13-25-44(36)8)30-18-21-33(22-19-30)46(27-41(2,3)4,28-42(5,6)7)32-14-10-9-11-15-32/h9-25H,27-28H2,1-8H3/q+1 |
| InChIKey | HAVHYIVFACUKOF-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.92 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|