C35H31N2OSi+ — CID 166038113
4-[4-[dimethyl(phenyl)silyl]phenyl]-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile (PubChem CID 166038113) has the molecular formula C35H31N2OSi+ and a molecular weight of 523.73 g/mol. Its IUPAC name is 4-[4-[dimethyl(phenyl)silyl]phenyl]-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile.
| Compound Name | 4-[4-[dimethyl(phenyl)silyl]phenyl]-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166038113 |
| Molecular Formula | C35H31N2OSi+ |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 4-[4-[dimethyl(phenyl)silyl]phenyl]-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2c(-c4ccc([Si](C)(C)c5ccccc5)cc4)c(C#N)ccc23)c1 |
| InChI | InChI=1S/C35H31N2OSi/c1-23-19-20-37(3)31(21-23)32-24(2)11-17-29-30-18-14-26(22-36)33(35(30)38-34(29)32)25-12-15-28(16-13-25)39(4,5)27-9-7-6-8-10-27/h6-21H,1-5H3/q+1 |
| InChIKey | BSMCWDXGGIVUKX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|