C35H25N2O+ — CID 169077161
4-(10-deuteriophenanthren-9-yl)-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile (PubChem CID 169077161) has the molecular formula C35H25N2O+ and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-(10-deuteriophenanthren-9-yl)-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile.
| Compound Name | 4-(10-deuteriophenanthren-9-yl)-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 169077161 |
| Molecular Formula | C35H25N2O+ |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 4-(10-deuteriophenanthren-9-yl)-6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyldibenzofuran-3-carbonitrile |
| SMILES | [2H]c1c(-c2c(C#N)ccc3c2oc2c(-c4cc(C)cc[n+]4C)c(C)ccc23)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C35H25N2O/c1-21-16-17-37(3)31(18-21)32-22(2)12-14-28-29-15-13-24(20-36)33(35(29)38-34(28)32)30-19-23-8-4-5-9-25(23)26-10-6-7-11-27(26)30/h4-19H,1-3H3/q+1/i19D |
| InChIKey | RBNILMUPPFAGKC-YUIGOLOMSA-N |
| XLogP | 8.54 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|