C39H33N2O+ — CID 169077170
4-(10-deuteriophenanthren-9-yl)-6-[5-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-3-carbonitrile (PubChem CID 169077170) has the molecular formula C39H33N2O+ and a molecular weight of 546.71 g/mol. Its IUPAC name is 4-(10-deuteriophenanthren-9-yl)-6-[5-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-3-carbonitrile.
| Compound Name | 4-(10-deuteriophenanthren-9-yl)-6-[5-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 169077170 |
| Molecular Formula | C39H33N2O+ |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 4-(10-deuteriophenanthren-9-yl)-6-[5-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-7-methyldibenzofuran-3-carbonitrile |
| SMILES | [2H]c1c(-c2c(C#N)ccc3c2oc2c(-c4ccc(CC(C)(C)C)c[n+]4C)c(C)ccc23)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C39H33N2O/c1-24-14-17-31-32-18-16-27(22-40)36(33-20-26-10-6-7-11-28(26)29-12-8-9-13-30(29)33)38(32)42-37(31)35(24)34-19-15-25(23-41(34)5)21-39(2,3)4/h6-20,23H,21H2,1-5H3/q+1/i20D |
| InChIKey | USVPAFHXIVQZCN-YVHRXSIGSA-N |
| XLogP | 9.82 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|