C28H20N3O+ — CID 166043386
6-(1,5-dimethylpyridin-1-ium-2-yl)-4-(2-isocyanophenyl)-7-methyldibenzofuran-3-carbonitrile (PubChem CID 166043386) has the molecular formula C28H20N3O+ and a molecular weight of 414.49 g/mol. Its IUPAC name is 6-(1,5-dimethylpyridin-1-ium-2-yl)-4-(2-isocyanophenyl)-7-methyldibenzofuran-3-carbonitrile.
| Compound Name | 6-(1,5-dimethylpyridin-1-ium-2-yl)-4-(2-isocyanophenyl)-7-methyldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166043386 |
| Molecular Formula | C28H20N3O+ |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 6-(1,5-dimethylpyridin-1-ium-2-yl)-4-(2-isocyanophenyl)-7-methyldibenzofuran-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1c(C#N)ccc2c1oc1c(-c3ccc(C)c[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C28H20N3O/c1-17-9-14-24(31(4)16-17)25-18(2)10-12-20-21-13-11-19(15-29)26(28(21)32-27(20)25)22-7-5-6-8-23(22)30-3/h5-14,16H,1-2,4H3/q+1 |
| InChIKey | MVHBXXHWKVVQHK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 45.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|