C26H21FNO+ — CID 153464671
2-(7-fluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium (PubChem CID 153464671) has the molecular formula C26H21FNO+ and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(7-fluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-(7-fluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 153464671 |
| Molecular Formula | C26H21FNO+ |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-(7-fluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)ccc3c2oc2c(-c4ccccc4)c(F)ccc23)[n+](C)c1 |
| InChI | InChI=1S/C26H21FNO/c1-16-9-14-22(28(3)15-16)23-17(2)10-11-19-20-12-13-21(27)24(26(20)29-25(19)23)18-7-5-4-6-8-18/h4-15H,1-3H3/q+1 |
| InChIKey | BRRREHGDENAVEY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|