C32H37FNO+ — CID 166037572
2-[6-(4-cyclohexylcyclohexyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium (PubChem CID 166037572) has the molecular formula C32H37FNO+ and a molecular weight of 470.65 g/mol. Its IUPAC name is 2-[6-(4-cyclohexylcyclohexyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-[6-(4-cyclohexylcyclohexyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 166037572 |
| Molecular Formula | C32H37FNO+ |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 2-[6-(4-cyclohexylcyclohexyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)ccc3c2oc2c(C4CCC(C5CCCCC5)CC4)c(F)ccc23)[n+](C)c1 |
| InChI | InChI=1S/C32H37FNO/c1-20-9-18-28(34(3)19-20)29-21(2)10-15-25-26-16-17-27(33)30(32(26)35-31(25)29)24-13-11-23(12-14-24)22-7-5-4-6-8-22/h9-10,15-19,22-24H,4-8,11-14H2,1-3H3/q+1 |
| InChIKey | YTGXNORZUGLRTK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|