C37H38F2NO+ — CID 166038166
2-[6-[4-(4-cyclohexyl-1-deuteriocyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1-methylpyridin-1-ium (PubChem CID 166038166) has the molecular formula C37H38F2NO+ and a molecular weight of 551.72 g/mol. Its IUPAC name is 2-[6-[4-(4-cyclohexyl-1-deuteriocyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[4-(4-cyclohexyl-1-deuteriocyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166038166 |
| Molecular Formula | C37H38F2NO+ |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 2-[6-[4-(4-cyclohexyl-1-deuteriocyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-4-fluoro-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3c(F)ccc4c3oc3c(-c5cc(F)cc[n+]5C)c(C)ccc34)cc2)CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C37H38F2NO/c1-23-8-17-30-31-18-19-32(39)35(37(31)41-36(30)34(23)33-22-29(38)20-21-40(33)2)28-15-13-27(14-16-28)26-11-9-25(10-12-26)24-6-4-3-5-7-24/h8,13-22,24-26H,3-7,9-12H2,1-2H3/q+1/i26D |
| InChIKey | QYLCFCOYIGNSEO-HKAOEGRMSA-N |
| XLogP | 10.19 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|