C35H37FNO+ — CID 166038438
2-[6-(4-cyclohexylphenyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-4-(2-methylpropyl)pyridin-1-ium (PubChem CID 166038438) has the molecular formula C35H37FNO+ and a molecular weight of 506.69 g/mol. Its IUPAC name is 2-[6-(4-cyclohexylphenyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-4-(2-methylpropyl)pyridin-1-ium.
| Compound Name | 2-[6-(4-cyclohexylphenyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-4-(2-methylpropyl)pyridin-1-ium |
|---|---|
| PubChem CID | 166038438 |
| Molecular Formula | C35H37FNO+ |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[6-(4-cyclohexylphenyl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methyl-4-(2-methylpropyl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C5CCCCC5)cc4)c(F)ccc32)c1-c1cc(CC(C)C)cc[n+]1C |
| InChI | InChI=1S/C35H37FNO/c1-22(2)20-24-18-19-37(4)31(21-24)32-23(3)10-15-28-29-16-17-30(36)33(35(29)38-34(28)32)27-13-11-26(12-14-27)25-8-6-5-7-9-25/h10-19,21-22,25H,5-9,20H2,1-4H3/q+1 |
| InChIKey | CSMZSWDGDAUFHZ-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|