C32H31FNO+ — CID 166037982
2-[7-fluoro-3-methyl-6-[4-(4-methylcyclohexyl)phenyl]dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166037982) has the molecular formula C32H31FNO+ and a molecular weight of 464.60 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-[4-(4-methylcyclohexyl)phenyl]dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-[4-(4-methylcyclohexyl)phenyl]dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166037982 |
| Molecular Formula | C32H31FNO+ |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-[4-(4-methylcyclohexyl)phenyl]dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C5CCC(C)CC5)cc4)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C32H31FNO/c1-20-7-10-22(11-8-20)23-12-14-24(15-13-23)30-27(33)18-17-26-25-16-9-21(2)29(31(25)35-32(26)30)28-6-4-5-19-34(28)3/h4-6,9,12-20,22H,7-8,10-11H2,1-3H3/q+1 |
| InChIKey | FAABAKASWPEDCK-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|