C33H33FNO+ — CID 166037790
2-[6-[3-(4,4-dimethylcyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166037790) has the molecular formula C33H33FNO+ and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-[6-[3-(4,4-dimethylcyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[3-(4,4-dimethylcyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166037790 |
| Molecular Formula | C33H33FNO+ |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-[6-[3-(4,4-dimethylcyclohexyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cccc(C5CCC(C)(C)CC5)c4)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C33H33FNO/c1-21-11-12-25-26-13-14-27(34)30(32(26)36-31(25)29(21)28-10-5-6-19-35(28)4)24-9-7-8-23(20-24)22-15-17-33(2,3)18-16-22/h5-14,19-20,22H,15-18H2,1-4H3/q+1 |
| InChIKey | ZCMDPRHOYDPKJF-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|