C32H29FNO3+ — CID 166037950
2-[6-[4-(1,4-dioxaspiro[4.4]nonan-8-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166037950) has the molecular formula C32H29FNO3+ and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-[6-[4-(1,4-dioxaspiro[4.4]nonan-8-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[4-(1,4-dioxaspiro[4.4]nonan-8-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166037950 |
| Molecular Formula | C32H29FNO3+ |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-[6-[4-(1,4-dioxaspiro[4.4]nonan-8-yl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C5CCC6(C5)OCCO6)cc4)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C32H29FNO3/c1-20-6-11-24-25-12-13-26(33)29(31(25)37-30(24)28(20)27-5-3-4-16-34(27)2)22-9-7-21(8-10-22)23-14-15-32(19-23)35-17-18-36-32/h3-13,16,23H,14-15,17-19H2,1-2H3/q+1 |
| InChIKey | BKPADIYUXJHNHR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 35.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|