C35H35FNO+ — CID 166037573
2-[7-fluoro-3-methyl-6-(4-spiro[4.5]decan-8-ylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166037573) has the molecular formula C35H35FNO+ and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-(4-spiro[4.5]decan-8-ylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-(4-spiro[4.5]decan-8-ylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166037573 |
| Molecular Formula | C35H35FNO+ |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-(4-spiro[4.5]decan-8-ylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C5CCC6(CCCC6)CC5)cc4)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C35H35FNO/c1-23-8-13-27-28-14-15-29(36)32(34(28)38-33(27)31(23)30-7-3-6-22-37(30)2)26-11-9-24(10-12-26)25-16-20-35(21-17-25)18-4-5-19-35/h3,6-15,22,25H,4-5,16-21H2,1-2H3/q+1 |
| InChIKey | SIFZANNORKCMSL-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|