C37H37N2O+ — CID 166037706
7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(3-spiro[5.5]undecan-3-ylphenyl)dibenzofuran-3-carbonitrile (PubChem CID 166037706) has the molecular formula C37H37N2O+ and a molecular weight of 525.72 g/mol. Its IUPAC name is 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(3-spiro[5.5]undecan-3-ylphenyl)dibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(3-spiro[5.5]undecan-3-ylphenyl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166037706 |
| Molecular Formula | C37H37N2O+ |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 7-methyl-6-(1-methylpyridin-1-ium-2-yl)-4-(3-spiro[5.5]undecan-3-ylphenyl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4cccc(C5CCC6(CCCCC6)CC5)c4)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C37H37N2O/c1-25-12-14-30-31-15-13-29(24-38)34(36(31)40-35(30)33(25)32-11-4-7-22-39(32)2)28-10-8-9-27(23-28)26-16-20-37(21-17-26)18-5-3-6-19-37/h4,7-15,22-23,26H,3,5-6,16-21H2,1-2H3/q+1 |
| InChIKey | QYOHZEFSWIBARY-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|