C35H27N2O+ — CID 164849563
4-(9,9-dimethylfluoren-2-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 164849563) has the molecular formula C35H27N2O+ and a molecular weight of 491.61 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 164849563 |
| Molecular Formula | C35H27N2O+ |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C35H27N2O/c1-21-12-15-26-27-17-14-23(20-36)32(34(27)38-33(26)31(21)30-11-7-8-18-37(30)4)22-13-16-25-24-9-5-6-10-28(24)35(2,3)29(25)19-22/h5-19H,1-4H3/q+1 |
| InChIKey | ZLKHNJDBIRXVBW-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|