C33H25N2O+ — CID 164849317
7-methyl-4-[3-(4-methylphenyl)phenyl]-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 164849317) has the molecular formula C33H25N2O+ and a molecular weight of 465.58 g/mol. Its IUPAC name is 7-methyl-4-[3-(4-methylphenyl)phenyl]-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-4-[3-(4-methylphenyl)phenyl]-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 164849317 |
| Molecular Formula | C33H25N2O+ |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 7-methyl-4-[3-(4-methylphenyl)phenyl]-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc(-c2cccc(-c3c(C#N)ccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c2)cc1 |
| InChI | InChI=1S/C33H25N2O/c1-21-10-13-23(14-11-21)24-7-6-8-25(19-24)31-26(20-34)15-17-28-27-16-12-22(2)30(32(27)36-33(28)31)29-9-4-5-18-35(29)3/h4-19H,1-3H3/q+1 |
| InChIKey | DLQAALBGDCLTQG-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|