C36H31N2O+ — CID 164849476
6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-[3-(4-propan-2-ylphenyl)phenyl]dibenzofuran-3-carbonitrile (PubChem CID 164849476) has the molecular formula C36H31N2O+ and a molecular weight of 507.66 g/mol. Its IUPAC name is 6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-[3-(4-propan-2-ylphenyl)phenyl]dibenzofuran-3-carbonitrile.
| Compound Name | 6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-[3-(4-propan-2-ylphenyl)phenyl]dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 164849476 |
| Molecular Formula | C36H31N2O+ |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 6-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-4-[3-(4-propan-2-ylphenyl)phenyl]dibenzofuran-3-carbonitrile |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2c(-c4cccc(-c5ccc(C(C)C)cc5)c4)c(C#N)ccc23)c1 |
| InChI | InChI=1S/C36H31N2O/c1-22(2)25-10-12-26(13-11-25)27-7-6-8-28(20-27)34-29(21-37)14-16-31-30-15-9-24(4)33(35(30)39-36(31)34)32-19-23(3)17-18-38(32)5/h6-20,22H,1-5H3/q+1 |
| InChIKey | XBVKLZHFVWNYGC-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|