C32H32BFNO+ — CID 166037672
(4-cyclohexylphenyl)-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methylborane (PubChem CID 166037672) has the molecular formula C32H32BFNO+ and a molecular weight of 476.42 g/mol. Its IUPAC name is (4-cyclohexylphenyl)-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methylborane.
| Compound Name | (4-cyclohexylphenyl)-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methylborane |
|---|---|
| PubChem CID | 166037672 |
| Molecular Formula | C32H32BFNO+ |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (4-cyclohexylphenyl)-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methylborane |
| SMILES | CB(c1ccc(C2CCCCC2)cc1)c1c(F)ccc2c1oc1c(-c3cccc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C32H32BFNO/c1-21-12-17-25-26-18-19-27(34)30(32(26)36-31(25)29(21)28-11-7-8-20-35(28)3)33(2)24-15-13-23(14-16-24)22-9-5-4-6-10-22/h7-8,11-20,22H,4-6,9-10H2,1-3H3/q+1 |
| InChIKey | APUOAHVNUIEHRD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|