C32H26BFNO+ — CID 166038418
[4-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]phenyl]-methyl-phenylborane (PubChem CID 166038418) has the molecular formula C32H26BFNO+ and a molecular weight of 470.38 g/mol. Its IUPAC name is [4-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]phenyl]-methyl-phenylborane.
| Compound Name | [4-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]phenyl]-methyl-phenylborane |
|---|---|
| PubChem CID | 166038418 |
| Molecular Formula | C32H26BFNO+ |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [4-[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]phenyl]-methyl-phenylborane |
| SMILES | CB(c1ccccc1)c1ccc(-c2c(F)ccc3c2oc2c(-c4cccc[n+]4C)c(C)ccc23)cc1 |
| InChI | InChI=1S/C32H26BFNO/c1-21-12-17-25-26-18-19-27(34)30(32(26)36-31(25)29(21)28-11-7-8-20-35(28)3)22-13-15-24(16-14-22)33(2)23-9-5-4-6-10-23/h4-20H,1-3H3/q+1 |
| InChIKey | HIPHABFCYGKYBV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|